C24H27BrNOP — CID 134872013
2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-diethylacetamide (PubChem CID 134872013) has the molecular formula C24H27BrNOP and a molecular weight of 456.36 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-diethylacetamide.
| Compound Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 134872013 |
| Molecular Formula | C24H27BrNOP |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27BrNOP/c1-3-26(4-2)24(27)20-28(25,21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-19H,3-4,20H2,1-2H3 |
| InChIKey | WLZNOMYWRHGQML-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|