C20H32O8 — CID 134872878
methyl (2R,3R)-3-[(Z)-[(3aR,5S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]methyl]-2-hydroxy-4-methylpentanoate (PubChem CID 134872878) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is methyl (2R,3R)-3-[(Z)-[(3aR,5S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]methyl]-2-hydroxy-4-methylpentanoate.
| Compound Name | methyl (2R,3R)-3-[(Z)-[(3aR,5S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]methyl]-2-hydroxy-4-methylpentanoate |
|---|---|
| PubChem CID | 134872878 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | methyl (2R,3R)-3-[(Z)-[(3aR,5S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]methyl]-2-hydroxy-4-methylpentanoate |
| SMILES | COC(=O)[C@H](O)[C@@H](/C=C1\[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C1COC(C)(C)O1)C(C)C |
| InChI | InChI=1S/C20H32O8/c1-10(2)11(14(21)17(22)23-7)8-12-15(13-9-24-19(3,4)26-13)25-18-16(12)27-20(5,6)28-18/h8,10-11,13-16,18,21H,9H2,1-7H3/b12-8-/t11-,13?,14+,15-,16+,18+/m0/s1 |
| InChIKey | DBDHHBVIIMIWKY-UYPIQXPHSA-N |
| XLogP | 1.75 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|