C22H34O3Si — CID 134872890
(1S,6R,7S,10R)-7-[tert-butyl(dimethyl)silyl]oxy-10-cyclohexa-1,3-dien-1-yl-6-methyl-4-oxatricyclo[4.4.0.02,10]decan-3-one (PubChem CID 134872890) has the molecular formula C22H34O3Si and a molecular weight of 374.60 g/mol. Its IUPAC name is (1S,6R,7S,10R)-7-[tert-butyl(dimethyl)silyl]oxy-10-cyclohexa-1,3-dien-1-yl-6-methyl-4-oxatricyclo[4.4.0.02,10]decan-3-one.
| Compound Name | (1S,6R,7S,10R)-7-[tert-butyl(dimethyl)silyl]oxy-10-cyclohexa-1,3-dien-1-yl-6-methyl-4-oxatricyclo[4.4.0.02,10]decan-3-one |
|---|---|
| PubChem CID | 134872890 |
| Molecular Formula | C22H34O3Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (1S,6R,7S,10R)-7-[tert-butyl(dimethyl)silyl]oxy-10-cyclohexa-1,3-dien-1-yl-6-methyl-4-oxatricyclo[4.4.0.02,10]decan-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@]2(C3=CC=CCC3)C3C(=O)OC[C@@]1(C)[C@@H]32 |
| InChI | InChI=1S/C22H34O3Si/c1-20(2,3)26(5,6)25-16-12-13-22(15-10-8-7-9-11-15)17-18(22)21(16,4)14-24-19(17)23/h7-8,10,16-18H,9,11-14H2,1-6H3/t16-,17?,18+,21+,22-/m0/s1 |
| InChIKey | VFCNKZJFALNURL-ISDOGOIWSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|