C22H34O3Si — CID 134916294
(1S,5R,6S,15R,16S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-9,13-dien-2-one (PubChem CID 134916294) has the molecular formula C22H34O3Si and a molecular weight of 374.60 g/mol. Its IUPAC name is (1S,5R,6S,15R,16S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-9,13-dien-2-one.
| Compound Name | (1S,5R,6S,15R,16S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-9,13-dien-2-one |
|---|---|
| PubChem CID | 134916294 |
| Molecular Formula | C22H34O3Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (1S,5R,6S,15R,16S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-9,13-dien-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC2=C3CCC=C[C@@H]3[C@@H]3C(=O)OC[C@@]1(C)[C@H]23 |
| InChI | InChI=1S/C22H34O3Si/c1-21(2,3)26(5,6)25-17-12-11-16-14-9-7-8-10-15(14)18-19(16)22(17,4)13-24-20(18)23/h8,10,15,17-19H,7,9,11-13H2,1-6H3/t15-,17-,18-,19+,22+/m0/s1 |
| InChIKey | ZJQUDBANIBZXFQ-JGFQCWQPSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|