C31H54O4Si — CID 140971570
methyl 2-[(3S,7S,8R,9S,10S,13S,14S)-7-methoxy-10-methyl-3-tri(propan-2-yl)silyloxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]acetate (PubChem CID 140971570) has the molecular formula C31H54O4Si and a molecular weight of 518.86 g/mol. Its IUPAC name is methyl 2-[(3S,7S,8R,9S,10S,13S,14S)-7-methoxy-10-methyl-3-tri(propan-2-yl)silyloxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]acetate.
| Compound Name | methyl 2-[(3S,7S,8R,9S,10S,13S,14S)-7-methoxy-10-methyl-3-tri(propan-2-yl)silyloxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]acetate |
|---|---|
| PubChem CID | 140971570 |
| Molecular Formula | C31H54O4Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | methyl 2-[(3S,7S,8R,9S,10S,13S,14S)-7-methoxy-10-methyl-3-tri(propan-2-yl)silyloxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]acetate |
| SMILES | COC(=O)C[C@@]12C=CC[C@H]1[C@@H]1[C@@H](OC)CC3C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C31H54O4Si/c1-20(2)36(21(3)4,22(5)6)35-24-12-15-30(7)23(17-24)18-27(33-8)29-25(30)13-16-31(19-28(32)34-9)14-10-11-26(29)31/h10,14,20-27,29H,11-13,15-19H2,1-9H3/t23?,24-,25-,26-,27-,29+,30-,31-/m0/s1 |
| InChIKey | UAAGJMYHXHTZFS-IJIJXWPCSA-N |
| XLogP | 7.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|