About (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane
(1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane (PubChem CID 134873347) has the molecular formula C15H25O3P
and a molecular weight of 284.34 g/mol. Its IUPAC name is (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane.
Molecular Properties
| Compound Name | (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane |
| PubChem CID | 134873347 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane |
| SMILES | COP(=O)(C=C=C(C1CCCC1)C1CCCC1)OC |
| InChI | InChI=1S/C15H25O3P/c1-17-19(16,18-2)12-11-15(13-7-3-4-8-13)14-9-5-6-10-14/h12-14H,3-10H2,1-2H3 |
| InChIKey | GMBVOHJFKHCPQU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane?
The IUPAC name of (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane (CID 134873347) is (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane.
What is the SMILES notation for (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane?
The canonical SMILES for (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane is COP(=O)(C=C=C(C1CCCC1)C1CCCC1)OC.
What is the InChIKey of (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane?
The InChIKey is GMBVOHJFKHCPQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25O3P/c1-17-19(16,18-2)12-11-15(13-7-3-4-8-13)14-9-5-6-10-14/h12-14H,3-10H2,1-2H3.
What are the key properties of (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane?
(1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane has a molecular weight of 284.34 g/mol, XLogP of 4.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclopentyl-3-dimethoxyphosphorylpropa-1,2-dienyl)cyclopentane is sourced from PubChem (CID 134873347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).