C14H29O3P — CID 134895023
(E)-1-diethoxyphosphoryl-2,3-dimethyloct-1-ene (PubChem CID 134895023) has the molecular formula C14H29O3P and a molecular weight of 276.36 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-2,3-dimethyloct-1-ene.
| Compound Name | (E)-1-diethoxyphosphoryl-2,3-dimethyloct-1-ene |
|---|---|
| PubChem CID | 134895023 |
| Molecular Formula | C14H29O3P |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-2,3-dimethyloct-1-ene |
| SMILES | CCCCCC(C)/C(C)=C/P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H29O3P/c1-6-9-10-11-13(4)14(5)12-18(15,16-7-2)17-8-3/h12-13H,6-11H2,1-5H3/b14-12+ |
| InChIKey | NUMNLEHENLWXIN-WYMLVPIESA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|