C14H29O3P — CID 10588496
(3E)-3-(diethoxyphosphorylmethylidene)-2,2-dimethylheptane (PubChem CID 10588496) has the molecular formula C14H29O3P and a molecular weight of 276.36 g/mol. Its IUPAC name is (3E)-3-(diethoxyphosphorylmethylidene)-2,2-dimethylheptane.
| Compound Name | (3E)-3-(diethoxyphosphorylmethylidene)-2,2-dimethylheptane |
|---|---|
| PubChem CID | 10588496 |
| Molecular Formula | C14H29O3P |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (3E)-3-(diethoxyphosphorylmethylidene)-2,2-dimethylheptane |
| SMILES | CCCC/C(=C\P(=O)(OCC)OCC)C(C)(C)C |
| InChI | InChI=1S/C14H29O3P/c1-7-10-11-13(14(4,5)6)12-18(15,16-8-2)17-9-3/h12H,7-11H2,1-6H3/b13-12+ |
| InChIKey | NQWCMUASLUDNKY-OUKQBFOZSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|