C20H43O2P — CID 158926281
2,7-dimethyl-4-methylideneoctane;2-methyl-1-[methyl(2-methylpropyl)phosphoryl]oxypropane (PubChem CID 158926281) has the molecular formula C20H43O2P and a molecular weight of 346.54 g/mol. Its IUPAC name is 2,7-dimethyl-4-methylideneoctane;2-methyl-1-[methyl(2-methylpropyl)phosphoryl]oxypropane.
| Compound Name | 2,7-dimethyl-4-methylideneoctane;2-methyl-1-[methyl(2-methylpropyl)phosphoryl]oxypropane |
|---|---|
| PubChem CID | 158926281 |
| Molecular Formula | C20H43O2P |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 2,7-dimethyl-4-methylideneoctane;2-methyl-1-[methyl(2-methylpropyl)phosphoryl]oxypropane |
| SMILES | C=C(CCC(C)C)CC(C)C.CC(C)COP(C)(=O)CC(C)C |
| InChI | InChI=1S/C11H22.C9H21O2P/c1-9(2)6-7-11(5)8-10(3)4;1-8(2)6-11-12(5,10)7-9(3)4/h9-10H,5-8H2,1-4H3;8-9H,6-7H2,1-5H3 |
| InChIKey | JIMFWEUYJJIJLT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|