C24H49O3P — CID 76593813
1-diethoxyphosphoryl-3,7,11,15-tetramethylhexadec-2-ene (PubChem CID 76593813) has the molecular formula C24H49O3P and a molecular weight of 416.63 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-3,7,11,15-tetramethylhexadec-2-ene.
| Compound Name | 1-diethoxyphosphoryl-3,7,11,15-tetramethylhexadec-2-ene |
|---|---|
| PubChem CID | 76593813 |
| Molecular Formula | C24H49O3P |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | 1-diethoxyphosphoryl-3,7,11,15-tetramethylhexadec-2-ene |
| SMILES | CCOP(=O)(CC=C(C)CCCC(C)CCCC(C)CCCC(C)C)OCC |
| InChI | InChI=1S/C24H49O3P/c1-8-26-28(25,27-9-2)20-19-24(7)18-12-17-23(6)16-11-15-22(5)14-10-13-21(3)4/h19,21-23H,8-18,20H2,1-7H3 |
| InChIKey | BJMQJKSKZCOQNR-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|