C20H37O7P2-3 — CID 25244232
[oxido-[(2E)-3,7,11,15-tetramethylhexadeca-2,14-dienoxy]phosphoryl] phosphate (PubChem CID 25244232) has the molecular formula C20H37O7P2-3 and a molecular weight of 451.46 g/mol. Its IUPAC name is [oxido-[(2E)-3,7,11,15-tetramethylhexadeca-2,14-dienoxy]phosphoryl] phosphate.
| Compound Name | [oxido-[(2E)-3,7,11,15-tetramethylhexadeca-2,14-dienoxy]phosphoryl] phosphate |
|---|---|
| PubChem CID | 25244232 |
| Molecular Formula | C20H37O7P2-3 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [oxido-[(2E)-3,7,11,15-tetramethylhexadeca-2,14-dienoxy]phosphoryl] phosphate |
| SMILES | CC(C)=CCCC(C)CCCC(C)CCC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C20H40O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h9,15,18-19H,6-8,10-14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/p-3/b20-15+ |
| InChIKey | VZBGWADXUJSBTI-HMMYKYKNSA-K |
| XLogP | 4.62 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|