C17H22O4 — CID 134874026
(3Z)-2,3,4-trimethoxytetradeca-1,3-dien-5,9-diyn-1-one (PubChem CID 134874026) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3Z)-2,3,4-trimethoxytetradeca-1,3-dien-5,9-diyn-1-one.
| Compound Name | (3Z)-2,3,4-trimethoxytetradeca-1,3-dien-5,9-diyn-1-one |
|---|---|
| PubChem CID | 134874026 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (3Z)-2,3,4-trimethoxytetradeca-1,3-dien-5,9-diyn-1-one |
| SMILES | CCCCC#CCCC#C/C(OC)=C(/OC)C(=C=O)OC |
| InChI | InChI=1S/C17H22O4/c1-5-6-7-8-9-10-11-12-13-15(19-2)17(21-4)16(14-18)20-3/h5-7,10-11H2,1-4H3/b17-15- |
| InChIKey | UAIYWGKFPPHWRP-ICFOKQHNSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|