About 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate
4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate (PubChem CID 134874104) has the molecular formula C27H25O5P
and a molecular weight of 460.47 g/mol. Its IUPAC name is 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate.
Molecular Properties
| Compound Name | 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate |
| PubChem CID | 134874104 |
| Molecular Formula | C27H25O5P |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate |
| SMILES | COC(=O)/C(=C/C(C)=C\c1ccccc1)CC(=O)OP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25O5P/c1-21(18-22-12-6-3-7-13-22)19-23(27(29)31-2)20-26(28)32-33(30,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-19H,20H2,1-2H3/b21-18-,23-19+ |
| InChIKey | CUJJKYHJXCSZKS-AAMGJSRISA-N |
| XLogP | 5.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate?
The IUPAC name of 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate (CID 134874104) is 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate.
What is the SMILES notation for 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate?
The canonical SMILES for 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate is COC(=O)/C(=C/C(C)=C\c1ccccc1)CC(=O)OP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate?
The InChIKey is CUJJKYHJXCSZKS-AAMGJSRISA-N. The full InChI is InChI=1S/C27H25O5P/c1-21(18-22-12-6-3-7-13-22)19-23(27(29)31-2)20-26(28)32-33(30,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-19H,20H2,1-2H3/b21-18-,23-19+.
What are the key properties of 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate?
4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate has a molecular weight of 460.47 g/mol, XLogP of 5.05, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-diphenylphosphoryl 1-O-methyl (2E)-2-[(Z)-2-methyl-3-phenylprop-2-enylidene]butanedioate is sourced from PubChem (CID 134874104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).