C19H28N2O3 — CID 134874320
tert-butyl (4S,5S)-4-(benzyliminomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134874320) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-(benzyliminomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-(benzyliminomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134874320 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl (4S,5S)-4-(benzyliminomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C19H28N2O3/c1-14-16(13-20-12-15-10-8-7-9-11-15)21(19(5,6)23-14)17(22)24-18(2,3)4/h7-11,13-14,16H,12H2,1-6H3/b20-13+/t14-,16-/m0/s1 |
| InChIKey | ALMOUYNPISDDSG-NTGHFPBUSA-N |
| XLogP | 4.02 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|