About methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate
methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate (PubChem CID 134874718) has the molecular formula C14H18F3NO3SSe
and a molecular weight of 416.32 g/mol. Its IUPAC name is methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate |
| PubChem CID | 134874718 |
| Molecular Formula | C14H18F3NO3SSe |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate |
| SMILES | C=CCC(/C(=[NH+]/C)[Se]C)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H17NSe.CHF3O3S/c1-4-8-12(13(14-2)15-3)11-9-6-5-7-10-11;2-1(3,4)8(5,6)7/h4-7,9-10,12H,1,8H2,2-3H3;(H,5,6,7)/b14-13-; |
| InChIKey | HXUBWUDSMZMCOL-HPWRNOGASA-N |
| XLogP | 1.26 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate?
The IUPAC name of methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate (CID 134874718) is methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate.
What is the SMILES notation for methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate?
The canonical SMILES for methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate is C=CCC(/C(=[NH+]/C)[Se]C)c1ccccc1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate?
The InChIKey is HXUBWUDSMZMCOL-HPWRNOGASA-N. The full InChI is InChI=1S/C13H17NSe.CHF3O3S/c1-4-8-12(13(14-2)15-3)11-9-6-5-7-10-11;2-1(3,4)8(5,6)7/h4-7,9-10,12H,1,8H2,2-3H3;(H,5,6,7)/b14-13-;.
What are the key properties of methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate?
methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate has a molecular weight of 416.32 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate is sourced from PubChem (CID 134874718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).