C17H22F3NO3SSe — CID 134874582
methyl-(1-methylselanyl-2-phenylpent-4-enylidene)-prop-2-enylazanium;trifluoromethanesulfonate (PubChem CID 134874582) has the molecular formula C17H22F3NO3SSe and a molecular weight of 456.39 g/mol. Its IUPAC name is methyl-(1-methylselanyl-2-phenylpent-4-enylidene)-prop-2-enylazanium;trifluoromethanesulfonate.
| Compound Name | methyl-(1-methylselanyl-2-phenylpent-4-enylidene)-prop-2-enylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134874582 |
| Molecular Formula | C17H22F3NO3SSe |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | methyl-(1-methylselanyl-2-phenylpent-4-enylidene)-prop-2-enylazanium;trifluoromethanesulfonate |
| SMILES | C=CCC(/C([Se]C)=[N+](\C)CC=C)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H22NSe.CHF3O3S/c1-5-10-15(14-11-8-7-9-12-14)16(18-4)17(3)13-6-2;2-1(3,4)8(5,6)7/h5-9,11-12,15H,1-2,10,13H2,3-4H3;(H,5,6,7)/q+1;/p-1/b17-16-; |
| InChIKey | FUKVEBAWKOVDPC-XYJRJTJESA-M |
| XLogP | 3.38 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|