C20H20F3NO3S — CID 134925077
(2,3-diphenylcycloprop-2-en-1-ylidene)-diethylazanium;trifluoromethanesulfonate (PubChem CID 134925077) has the molecular formula C20H20F3NO3S and a molecular weight of 411.45 g/mol. Its IUPAC name is (2,3-diphenylcycloprop-2-en-1-ylidene)-diethylazanium;trifluoromethanesulfonate.
| Compound Name | (2,3-diphenylcycloprop-2-en-1-ylidene)-diethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134925077 |
| Molecular Formula | C20H20F3NO3S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (2,3-diphenylcycloprop-2-en-1-ylidene)-diethylazanium;trifluoromethanesulfonate |
| SMILES | CC[N+](CC)=c1c(-c2ccccc2)c1-c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H20N.CHF3O3S/c1-3-20(4-2)19-17(15-11-7-5-8-12-15)18(19)16-13-9-6-10-14-16;2-1(3,4)8(5,6)7/h5-14H,3-4H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | MNWWTMQLSUNBAO-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|