C16H20F3NO3S — CID 11845714
(4,4-dimethyl-1-phenylpent-2-ynylidene)-dimethylazanium;trifluoromethanesulfonate (PubChem CID 11845714) has the molecular formula C16H20F3NO3S and a molecular weight of 363.40 g/mol. Its IUPAC name is (4,4-dimethyl-1-phenylpent-2-ynylidene)-dimethylazanium;trifluoromethanesulfonate.
| Compound Name | (4,4-dimethyl-1-phenylpent-2-ynylidene)-dimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11845714 |
| Molecular Formula | C16H20F3NO3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (4,4-dimethyl-1-phenylpent-2-ynylidene)-dimethylazanium;trifluoromethanesulfonate |
| SMILES | C[N+](C)=C(C#CC(C)(C)C)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H20N.CHF3O3S/c1-15(2,3)12-11-14(16(4)5)13-9-7-6-8-10-13;2-1(3,4)8(5,6)7/h6-10H,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | DTAUYEJQYPFMRS-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|