C20H26F3NO3SSi — CID 12972041
dimethyl-[phenyl-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]azanium;trifluoromethanesulfonate (PubChem CID 12972041) has the molecular formula C20H26F3NO3SSi and a molecular weight of 445.58 g/mol. Its IUPAC name is dimethyl-[phenyl-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]azanium;trifluoromethanesulfonate.
| Compound Name | dimethyl-[phenyl-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12972041 |
| Molecular Formula | C20H26F3NO3SSi |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | dimethyl-[phenyl-(3-trimethylsilyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]azanium;trifluoromethanesulfonate |
| SMILES | C[N+](C)=C(C1=C([Si](C)(C)C)C2C=CC1C2)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H26NSi.CHF3O3S/c1-20(2)18(14-9-7-6-8-10-14)17-15-11-12-16(13-15)19(17)21(3,4)5;2-1(3,4)8(5,6)7/h6-12,15-16H,13H2,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WBDPLDOKAFFHMO-UHFFFAOYSA-M |
| XLogP | 4.18 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|