C21H26F3NO3S — CID 135006913
[[(1S,4R)-3-tert-butyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]-phenylmethylidene]-dimethylazanium;trifluoromethanesulfonate (PubChem CID 135006913) has the molecular formula C21H26F3NO3S and a molecular weight of 429.50 g/mol. Its IUPAC name is [[(1S,4R)-3-tert-butyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]-phenylmethylidene]-dimethylazanium;trifluoromethanesulfonate.
| Compound Name | [[(1S,4R)-3-tert-butyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]-phenylmethylidene]-dimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135006913 |
| Molecular Formula | C21H26F3NO3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [[(1S,4R)-3-tert-butyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]-phenylmethylidene]-dimethylazanium;trifluoromethanesulfonate |
| SMILES | C[N+](C)=C(C1=C(C(C)(C)C)[C@H]2C=C[C@@H]1C2)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H26N.CHF3O3S/c1-20(2,3)18-16-12-11-15(13-16)17(18)19(21(4)5)14-9-7-6-8-10-14;2-1(3,4)8(5,6)7/h6-12,15-16H,13H2,1-5H3;(H,5,6,7)/q+1;/p-1/t15-,16+;/m1./s1 |
| InChIKey | DINZKTBHFVMWTL-RCPFAERMSA-M |
| XLogP | 4.35 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|