C20H22F3NO3S — CID 11845712
[[(1S,4R)-3-cyclopropyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]-phenylmethylidene]-dimethylazanium;trifluoromethanesulfonate (PubChem CID 11845712) has the molecular formula C20H22F3NO3S and a molecular weight of 413.46 g/mol. Its IUPAC name is [[(1S,4R)-3-cyclopropyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]-phenylmethylidene]-dimethylazanium;trifluoromethanesulfonate.
| Compound Name | [[(1S,4R)-3-cyclopropyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]-phenylmethylidene]-dimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11845712 |
| Molecular Formula | C20H22F3NO3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [[(1S,4R)-3-cyclopropyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]-phenylmethylidene]-dimethylazanium;trifluoromethanesulfonate |
| SMILES | C[N+](C)=C(C1=C(C2CC2)[C@H]2C=C[C@@H]1C2)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H22N.CHF3O3S/c1-20(2)19(14-6-4-3-5-7-14)18-16-11-10-15(12-16)17(18)13-8-9-13;2-1(3,4)8(5,6)7/h3-7,10-11,13,15-16H,8-9,12H2,1-2H3;(H,5,6,7)/q+1;/p-1/t15-,16+;/m0./s1 |
| InChIKey | SQOZTSAZEYBFAQ-IDVLALEDSA-M |
| XLogP | 3.71 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|