C13H20F3NO3SSi — CID 134877666
(E)-benzylidene-methyl-(trimethylsilylmethyl)azanium;trifluoromethanesulfonate (PubChem CID 134877666) has the molecular formula C13H20F3NO3SSi and a molecular weight of 355.45 g/mol. Its IUPAC name is (E)-benzylidene-methyl-(trimethylsilylmethyl)azanium;trifluoromethanesulfonate.
| Compound Name | (E)-benzylidene-methyl-(trimethylsilylmethyl)azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134877666 |
| Molecular Formula | C13H20F3NO3SSi |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (E)-benzylidene-methyl-(trimethylsilylmethyl)azanium;trifluoromethanesulfonate |
| SMILES | C/[N+](=C\c1ccccc1)C[Si](C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H20NSi.CHF3O3S/c1-13(11-14(2,3)4)10-12-8-6-5-7-9-12;2-1(3,4)8(5,6)7/h5-10H,11H2,1-4H3;(H,5,6,7)/q+1;/p-1/b13-10+; |
| InChIKey | CGOQSZZYLMRIRW-RSGUCCNWSA-M |
| XLogP | 2.68 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|