C22H26F3NO3SSe — CID 134874584
methyl-[(4-methylphenyl)methyl]-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate (PubChem CID 134874584) has the molecular formula C22H26F3NO3SSe and a molecular weight of 520.48 g/mol. Its IUPAC name is methyl-[(4-methylphenyl)methyl]-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate.
| Compound Name | methyl-[(4-methylphenyl)methyl]-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134874584 |
| Molecular Formula | C22H26F3NO3SSe |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | methyl-[(4-methylphenyl)methyl]-(1-methylselanyl-2-phenylpent-4-enylidene)azanium;trifluoromethanesulfonate |
| SMILES | C=CCC(/C([Se]C)=[N+](\C)Cc1ccc(C)cc1)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C21H26NSe.CHF3O3S/c1-5-9-20(19-10-7-6-8-11-19)21(23-4)22(3)16-18-14-12-17(2)13-15-18;2-1(3,4)8(5,6)7/h5-8,10-15,20H,1,9,16H2,2-4H3;(H,5,6,7)/q+1;/p-1/b22-21-; |
| InChIKey | AQOLVWUSKRIJDL-SVXKRPBISA-M |
| XLogP | 4.70 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|