C13H18F3NO3S — CID 135005414
benzyl-methyl-(2-methylpropylidene)azanium;trifluoromethanesulfonate (PubChem CID 135005414) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is benzyl-methyl-(2-methylpropylidene)azanium;trifluoromethanesulfonate.
| Compound Name | benzyl-methyl-(2-methylpropylidene)azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135005414 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | benzyl-methyl-(2-methylpropylidene)azanium;trifluoromethanesulfonate |
| SMILES | CC(C)/C=[N+](\C)Cc1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H18N.CHF3O3S/c1-11(2)9-13(3)10-12-7-5-4-6-8-12;2-1(3,4)8(5,6)7/h4-9,11H,10H2,1-3H3;(H,5,6,7)/q+1;/p-1/b13-9+; |
| InChIKey | UEZWLAZMKMQVBE-KJEVSKRMSA-M |
| XLogP | 2.61 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|