C18H20F3NO3SSe — CID 139265132
[2-[(1R)-1-[methyl-[(1R)-1-phenylethyl]amino]ethyl]phenyl]selanyl trifluoromethanesulfonate (PubChem CID 139265132) has the molecular formula C18H20F3NO3SSe and a molecular weight of 466.38 g/mol. Its IUPAC name is [2-[(1R)-1-[methyl-[(1R)-1-phenylethyl]amino]ethyl]phenyl]selanyl trifluoromethanesulfonate.
| Compound Name | [2-[(1R)-1-[methyl-[(1R)-1-phenylethyl]amino]ethyl]phenyl]selanyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139265132 |
| Molecular Formula | C18H20F3NO3SSe |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | [2-[(1R)-1-[methyl-[(1R)-1-phenylethyl]amino]ethyl]phenyl]selanyl trifluoromethanesulfonate |
| SMILES | C[C@H](c1ccccc1)N(C)[C@H](C)c1ccccc1[Se]OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO3SSe/c1-13(15-9-5-4-6-10-15)22(3)14(2)16-11-7-8-12-17(16)27-25-26(23,24)18(19,20)21/h4-14H,1-3H3/t13-,14-/m1/s1 |
| InChIKey | GZEPPHWTRGOPLU-ZIAGYGMSSA-N |
| XLogP | 3.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|