C18H22F3NO3S — CID 139267291
trifluoromethanesulfonate;trimethyl-[1-(4-phenylphenyl)ethyl]azanium (PubChem CID 139267291) has the molecular formula C18H22F3NO3S and a molecular weight of 389.44 g/mol. Its IUPAC name is trifluoromethanesulfonate;trimethyl-[1-(4-phenylphenyl)ethyl]azanium.
| Compound Name | trifluoromethanesulfonate;trimethyl-[1-(4-phenylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 139267291 |
| Molecular Formula | C18H22F3NO3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | trifluoromethanesulfonate;trimethyl-[1-(4-phenylphenyl)ethyl]azanium |
| SMILES | CC(c1ccc(-c2ccccc2)cc1)[N+](C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C17H22N.CHF3O3S/c1-14(18(2,3)4)15-10-12-17(13-11-15)16-8-6-5-7-9-16;2-1(3,4)8(5,6)7/h5-14H,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | CQHKBCUUBLKTPV-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|