C26H52O2Si2 — CID 134874966
(6R)-6-[(4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-trimethylsilylheptan-2-one (PubChem CID 134874966) has the molecular formula C26H52O2Si2 and a molecular weight of 452.87 g/mol. Its IUPAC name is (6R)-6-[(4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-trimethylsilylheptan-2-one.
| Compound Name | (6R)-6-[(4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-trimethylsilylheptan-2-one |
|---|---|
| PubChem CID | 134874966 |
| Molecular Formula | C26H52O2Si2 |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | (6R)-6-[(4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-trimethylsilylheptan-2-one |
| SMILES | CC(=O)C(CC[C@@H](C)C1CCC2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C)[Si](C)(C)C |
| InChI | InChI=1S/C26H52O2Si2/c1-19(14-17-24(20(2)27)29(7,8)9)21-15-16-22-23(13-12-18-26(21,22)6)28-30(10,11)25(3,4)5/h19,21-24H,12-18H2,1-11H3/t19-,21?,22?,23+,24?,26-/m1/s1 |
| InChIKey | KIGCFMIKGNPPNM-KANCSSRISA-N |
| XLogP | 8.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|