C24H44F2O3Si — CID 153284673
ethyl 5-[(4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluorohexanoate (PubChem CID 153284673) has the molecular formula C24H44F2O3Si and a molecular weight of 446.70 g/mol. Its IUPAC name is ethyl 5-[(4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluorohexanoate.
| Compound Name | ethyl 5-[(4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluorohexanoate |
|---|---|
| PubChem CID | 153284673 |
| Molecular Formula | C24H44F2O3Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | ethyl 5-[(4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluorohexanoate |
| SMILES | CCOC(=O)C(F)(F)CCC(C)C1CCC2[C@@H](O[Si](CC)(CC)CC)CCC[C@]12C |
| InChI | InChI=1S/C24H44F2O3Si/c1-7-28-22(27)24(25,26)17-15-18(5)19-13-14-20-21(12-11-16-23(19,20)6)29-30(8-2,9-3)10-4/h18-21H,7-17H2,1-6H3/t18?,19?,20?,21-,23+/m0/s1 |
| InChIKey | LNPVCMGUFLWARW-KITTYXGWSA-N |
| XLogP | 7.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|