C15H28N3+ — CID 134875137
[(Z)-2,3-di(piperidin-1-yl)prop-2-enylidene]-dimethylazanium (PubChem CID 134875137) has the molecular formula C15H28N3+ and a molecular weight of 250.41 g/mol. Its IUPAC name is [(Z)-2,3-di(piperidin-1-yl)prop-2-enylidene]-dimethylazanium.
| Compound Name | [(Z)-2,3-di(piperidin-1-yl)prop-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 134875137 |
| Molecular Formula | C15H28N3+ |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | [(Z)-2,3-di(piperidin-1-yl)prop-2-enylidene]-dimethylazanium |
| SMILES | C[N+](C)=C/C(=C/N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C15H28N3/c1-16(2)13-15(18-11-7-4-8-12-18)14-17-9-5-3-6-10-17/h13-14H,3-12H2,1-2H3/q+1 |
| InChIKey | YRPBXUYMFFPLCX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|