C21H31NO3 — CID 134875380
2-cyclopent-2-en-1-yl-N-[2-(7-hydroxyheptoxy)-5-methylphenyl]acetamide (PubChem CID 134875380) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-[2-(7-hydroxyheptoxy)-5-methylphenyl]acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-[2-(7-hydroxyheptoxy)-5-methylphenyl]acetamide |
|---|---|
| PubChem CID | 134875380 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-[2-(7-hydroxyheptoxy)-5-methylphenyl]acetamide |
| SMILES | Cc1ccc(OCCCCCCCO)c(NC(=O)CC2C=CCC2)c1 |
| InChI | InChI=1S/C21H31NO3/c1-17-11-12-20(25-14-8-4-2-3-7-13-23)19(15-17)22-21(24)16-18-9-5-6-10-18/h5,9,11-12,15,18,23H,2-4,6-8,10,13-14,16H2,1H3,(H,22,24) |
| InChIKey | CAKYNRBDVFCJLW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|