C19H22O4S — CID 134875516
(1-methyl-2-oxo-3,4,5,8-tetrahydronaphthalen-1-yl)methyl 4-methylbenzenesulfonate (PubChem CID 134875516) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is (1-methyl-2-oxo-3,4,5,8-tetrahydronaphthalen-1-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (1-methyl-2-oxo-3,4,5,8-tetrahydronaphthalen-1-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134875516 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (1-methyl-2-oxo-3,4,5,8-tetrahydronaphthalen-1-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(C)C(=O)CCC3=C2CC=CC3)cc1 |
| InChI | InChI=1S/C19H22O4S/c1-14-7-10-16(11-8-14)24(21,22)23-13-19(2)17-6-4-3-5-15(17)9-12-18(19)20/h3-4,7-8,10-11H,5-6,9,12-13H2,1-2H3 |
| InChIKey | ZDAFQRLLUAYNEM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|