C16H27LiO4Si — CID 134876299
lithium tert-butyl-[(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-(2H-furan-2-id-5-yl)methoxy]-dimethylsilane (PubChem CID 134876299) has the molecular formula C16H27LiO4Si and a molecular weight of 318.41 g/mol. Its IUPAC name is lithium tert-butyl-[(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-(2H-furan-2-id-5-yl)methoxy]-dimethylsilane.
| Compound Name | lithium tert-butyl-[(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-(2H-furan-2-id-5-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134876299 |
| Molecular Formula | C16H27LiO4Si |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | lithium tert-butyl-[(R)-(2,2-dimethyl-1,3-dioxolan-4-yl)-(2H-furan-2-id-5-yl)methoxy]-dimethylsilane |
| SMILES | CC1(C)OCC([C@@H](O[Si](C)(C)C(C)(C)C)c2cc[c-]o2)O1.[Li+] |
| InChI | InChI=1S/C16H27O4Si.Li/c1-15(2,3)21(6,7)20-14(12-9-8-10-17-12)13-11-18-16(4,5)19-13;/h8-9,13-14H,11H2,1-7H3;/q-1;+1/t13?,14-;/m0./s1 |
| InChIKey | PXZSKPNNPDFBHM-IJDFPQMLSA-N |
| XLogP | 1.30 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|