C22H40O5Si — CID 11004189
tert-butyl-[(1E,3E)-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxybuta-1,3-dienyl]-dimethylsilane (PubChem CID 11004189) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is tert-butyl-[(1E,3E)-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxybuta-1,3-dienyl]-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3E)-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxybuta-1,3-dienyl]-dimethylsilane |
|---|---|
| PubChem CID | 11004189 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | tert-butyl-[(1E,3E)-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxybuta-1,3-dienyl]-dimethylsilane |
| SMILES | CCOC(/C=C/[Si](C)(C)C(C)(C)C)=C/[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H40O5Si/c1-11-23-16(12-13-28(9,10)20(2,3)4)14-17-19(27-22(7,8)25-17)18-15-24-21(5,6)26-18/h12-14,17-19H,11,15H2,1-10H3/b13-12+,16-14+/t17-,18-,19+/m1/s1 |
| InChIKey | BBRDJYODVAIHSR-HHONUXFYSA-N |
| XLogP | 5.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|