C16H30O5Si — CID 134864608
2-[[(E)-3-[(3aS,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]prop-2-enoxy]methoxy]ethyl-trimethylsilane (PubChem CID 134864608) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-[[(E)-3-[(3aS,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]prop-2-enoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(E)-3-[(3aS,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]prop-2-enoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 134864608 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[[(E)-3-[(3aS,4S,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]prop-2-enoxy]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](/C=C/COCOCC[Si](C)(C)C)OC[C@H]2O1 |
| InChI | InChI=1S/C16H30O5Si/c1-16(2)20-14-11-19-13(15(14)21-16)7-6-8-17-12-18-9-10-22(3,4)5/h6-7,13-15H,8-12H2,1-5H3/b7-6+/t13-,14+,15-/m0/s1 |
| InChIKey | HIICKNGWEAGKIW-PZECUIMESA-N |
| XLogP | 2.79 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|