C24H46O5Sn — CID 10721039
[(Z)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enoxy]methyl-tributylstannane (PubChem CID 10721039) has the molecular formula C24H46O5Sn and a molecular weight of 533.34 g/mol. Its IUPAC name is [(Z)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enoxy]methyl-tributylstannane.
| Compound Name | [(Z)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enoxy]methyl-tributylstannane |
|---|---|
| PubChem CID | 10721039 |
| Molecular Formula | C24H46O5Sn |
| Molecular Weight | 533.34 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | [(Z)-3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enoxy]methyl-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)COC/C=C\[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H19O5.3C4H9.Sn/c1-12(2)16-9-8(6-5-7-13-3)15-11(14-4)10(9)17-12;3*1-3-4-2;/h5-6,8-11H,3,7H2,1-2,4H3;3*1,3-4H2,2H3;/b6-5-;;;;/t8-,9-,10-,11-;;;;/m1..../s1 |
| InChIKey | CPWTYEPVORNDCY-NISREJIESA-N |
| XLogP | 5.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|