C10H14O4 — CID 134963577
(1R,2R,6R,8R)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-9-ene (PubChem CID 134963577) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (1R,2R,6R,8R)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-9-ene.
| Compound Name | (1R,2R,6R,8R)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-9-ene |
|---|---|
| PubChem CID | 134963577 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1R,2R,6R,8R)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-9-ene |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C=CCO[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C10H14O4/c1-10(2)13-8-7-6(4-3-5-11-7)12-9(8)14-10/h3-4,6-9H,5H2,1-2H3/t6-,7-,8-,9-/m1/s1 |
| InChIKey | XFNVOIOMPJFKIV-FNCVBFRFSA-N |
| XLogP | 0.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|