C16H26O4Si — CID 59026925
3-[(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]prop-1-ynyl-trimethylsilane (PubChem CID 59026925) has the molecular formula C16H26O4Si and a molecular weight of 310.47 g/mol. Its IUPAC name is 3-[(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]prop-1-ynyl-trimethylsilane.
| Compound Name | 3-[(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]prop-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 59026925 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-[(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]prop-1-ynyl-trimethylsilane |
| SMILES | CO[C@H]1C=C[C@@H](CC2OCCO2)O[C@@H]1CC#C[Si](C)(C)C |
| InChI | InChI=1S/C16H26O4Si/c1-17-14-8-7-13(12-16-18-9-10-19-16)20-15(14)6-5-11-21(2,3)4/h7-8,13-16H,6,9-10,12H2,1-4H3/t13-,14-,15+/m0/s1 |
| InChIKey | BDJNQKCLMBGXOC-SOUVJXGZSA-N |
| XLogP | 2.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|