C23H40O3Si — CID 11574697
5-[(2R,5S)-5-[(1S)-1-(methoxymethoxy)prop-2-enyl]-2,5-dihydrofuran-2-yl]pent-1-ynyl-tri(propan-2-yl)silane (PubChem CID 11574697) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is 5-[(2R,5S)-5-[(1S)-1-(methoxymethoxy)prop-2-enyl]-2,5-dihydrofuran-2-yl]pent-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 5-[(2R,5S)-5-[(1S)-1-(methoxymethoxy)prop-2-enyl]-2,5-dihydrofuran-2-yl]pent-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11574697 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 5-[(2R,5S)-5-[(1S)-1-(methoxymethoxy)prop-2-enyl]-2,5-dihydrofuran-2-yl]pent-1-ynyl-tri(propan-2-yl)silane |
| SMILES | C=C[C@H](OCOC)[C@@H]1C=C[C@@H](CCCC#C[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C23H40O3Si/c1-9-22(25-17-24-8)23-15-14-21(26-23)13-11-10-12-16-27(18(2)3,19(4)5)20(6)7/h9,14-15,18-23H,1,10-11,13,17H2,2-8H3/t21-,22+,23+/m1/s1 |
| InChIKey | GWVDRIAKDKBDAX-VJBWXMMDSA-N |
| XLogP | 5.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|