C19H34O2Si — CID 11267255
tri(propan-2-yl)-[2-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane (PubChem CID 11267255) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane |
|---|---|
| PubChem CID | 11267255 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tri(propan-2-yl)-[2-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane |
| SMILES | CC(C)O[C@H]1C=CC[C@H](C#C[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C19H34O2Si/c1-14(2)20-19-11-9-10-18(21-19)12-13-22(15(3)4,16(5)6)17(7)8/h9,11,14-19H,10H2,1-8H3/t18-,19-/m1/s1 |
| InChIKey | OJUSWZULVCBRQL-RTBURBONSA-N |
| XLogP | 5.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|