C21H38O3Si — CID 11199420
triethyl-[(2S,3Z,5E)-4-ethyl-6-[(2R,6R)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]-2-methylhexa-3,5-dienoxy]silane (PubChem CID 11199420) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is triethyl-[(2S,3Z,5E)-4-ethyl-6-[(2R,6R)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]-2-methylhexa-3,5-dienoxy]silane.
| Compound Name | triethyl-[(2S,3Z,5E)-4-ethyl-6-[(2R,6R)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]-2-methylhexa-3,5-dienoxy]silane |
|---|---|
| PubChem CID | 11199420 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | triethyl-[(2S,3Z,5E)-4-ethyl-6-[(2R,6R)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]-2-methylhexa-3,5-dienoxy]silane |
| SMILES | CCC(=C/[C@H](C)CO[Si](CC)(CC)CC)/C=C/[C@H]1CC=C[C@H](OC)O1 |
| InChI | InChI=1S/C21H38O3Si/c1-7-19(14-15-20-12-11-13-21(22-6)24-20)16-18(5)17-23-25(8-2,9-3)10-4/h11,13-16,18,20-21H,7-10,12,17H2,1-6H3/b15-14+,19-16-/t18-,20+,21+/m0/s1 |
| InChIKey | SRZGSIKDMVMWFP-LJTBCYICSA-N |
| XLogP | 5.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|