C19H34O4Si — CID 10473348
[(2R,3S,6S)-6-methoxy-3-prop-2-ynoxy-3,6-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 10473348) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is [(2R,3S,6S)-6-methoxy-3-prop-2-ynoxy-3,6-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3S,6S)-6-methoxy-3-prop-2-ynoxy-3,6-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10473348 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [(2R,3S,6S)-6-methoxy-3-prop-2-ynoxy-3,6-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | C#CCO[C@H]1C=C[C@@H](OC)O[C@@H]1CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34O4Si/c1-9-12-21-17-10-11-19(20-8)23-18(17)13-22-24(14(2)3,15(4)5)16(6)7/h1,10-11,14-19H,12-13H2,2-8H3/t17-,18+,19-/m0/s1 |
| InChIKey | OOBQEJJUSPFRIE-OTWHNJEPSA-N |
| XLogP | 4.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|