C19H32O2Si — CID 134976296
tert-butyl-dimethyl-[[5-(3-methylidenehept-1-ynyl)-3,6-dihydro-2H-pyran-6-yl]oxy]silane (PubChem CID 134976296) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[5-(3-methylidenehept-1-ynyl)-3,6-dihydro-2H-pyran-6-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[5-(3-methylidenehept-1-ynyl)-3,6-dihydro-2H-pyran-6-yl]oxy]silane |
|---|---|
| PubChem CID | 134976296 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl-dimethyl-[[5-(3-methylidenehept-1-ynyl)-3,6-dihydro-2H-pyran-6-yl]oxy]silane |
| SMILES | C=C(C#CC1=CCCOC1O[Si](C)(C)C(C)(C)C)CCCC |
| InChI | InChI=1S/C19H32O2Si/c1-8-9-11-16(2)13-14-17-12-10-15-20-18(17)21-22(6,7)19(3,4)5/h12,18H,2,8-11,15H2,1,3-7H3 |
| InChIKey | UWSFGBVZKMFLEN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|