C26H46O3Si2 — CID 102163593
tert-butyl-dimethyl-[(3R,5E,7E)-6-methyl-8-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]-1-trimethylsilylocta-5,7-dien-1-yn-3-yl]oxysilane (PubChem CID 102163593) has the molecular formula C26H46O3Si2 and a molecular weight of 462.82 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,5E,7E)-6-methyl-8-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]-1-trimethylsilylocta-5,7-dien-1-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,5E,7E)-6-methyl-8-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]-1-trimethylsilylocta-5,7-dien-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 102163593 |
| Molecular Formula | C26H46O3Si2 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,5E,7E)-6-methyl-8-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]-1-trimethylsilylocta-5,7-dien-1-yn-3-yl]oxysilane |
| SMILES | CC(/C=C/[C@H]1CC=C[C@H](OC(C)C)O1)=C\C[C@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O3Si2/c1-21(2)27-25-14-12-13-23(28-25)17-15-22(3)16-18-24(19-20-30(7,8)9)29-31(10,11)26(4,5)6/h12,14-17,21,23-25H,13,18H2,1-11H3/b17-15+,22-16+/t23-,24-,25-/m1/s1 |
| InChIKey | KIDWDVPYXOKDMU-TUGKXMPTSA-N |
| XLogP | 7.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|