C22H40O3Si — CID 10500020
tert-butyl-[(2S,3Z,5E)-2,4-dimethyl-6-[(2S,6S)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-dimethylsilane (PubChem CID 10500020) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is tert-butyl-[(2S,3Z,5E)-2,4-dimethyl-6-[(2S,6S)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3Z,5E)-2,4-dimethyl-6-[(2S,6S)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10500020 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | tert-butyl-[(2S,3Z,5E)-2,4-dimethyl-6-[(2S,6S)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-dimethylsilane |
| SMILES | CC(=C/[C@H](C)CO[Si](C)(C)C(C)(C)C)/C=C/[C@@H]1CC=C[C@@H](OC(C)C)O1 |
| InChI | InChI=1S/C22H40O3Si/c1-17(2)24-21-12-10-11-20(25-21)14-13-18(3)15-19(4)16-23-26(8,9)22(5,6)7/h10,12-15,17,19-21H,11,16H2,1-9H3/b14-13+,18-15-/t19-,20-,21-/m0/s1 |
| InChIKey | KMOPQISUOLBHSU-XTHGZXGKSA-N |
| XLogP | 6.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|