C23H42O4Si2 — CID 11362658
tert-butyl-dimethyl-[[(2S,3R,6S)-2-propan-2-yloxy-3-prop-1-en-2-yloxy-4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]methoxy]silane (PubChem CID 11362658) has the molecular formula C23H42O4Si2 and a molecular weight of 438.76 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,3R,6S)-2-propan-2-yloxy-3-prop-1-en-2-yloxy-4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,3R,6S)-2-propan-2-yloxy-3-prop-1-en-2-yloxy-4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]methoxy]silane |
|---|---|
| PubChem CID | 11362658 |
| Molecular Formula | C23H42O4Si2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,3R,6S)-2-propan-2-yloxy-3-prop-1-en-2-yloxy-4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]methoxy]silane |
| SMILES | C=C(C)O[C@@H]1C(C#C[Si](C)(C)C)=C[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1OC(C)C |
| InChI | InChI=1S/C23H42O4Si2/c1-17(2)25-21-19(13-14-28(8,9)10)15-20(27-22(21)26-18(3)4)16-24-29(11,12)23(5,6)7/h15,18,20-22H,1,16H2,2-12H3/t20-,21+,22-/m0/s1 |
| InChIKey | XPYKJGIKXYWMAL-BDTNDASRSA-N |
| XLogP | 5.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|