C24H36O4 — CID 139609816
4-hept-1-enyl-5-[6-(2-methoxypropan-2-yloxy)oct-7-en-2,4-diynyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 139609816) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 4-hept-1-enyl-5-[6-(2-methoxypropan-2-yloxy)oct-7-en-2,4-diynyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-hept-1-enyl-5-[6-(2-methoxypropan-2-yloxy)oct-7-en-2,4-diynyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 139609816 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 4-hept-1-enyl-5-[6-(2-methoxypropan-2-yloxy)oct-7-en-2,4-diynyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CC(C#CC#CCC1OC(C)(C)OC1C=CCCCCC)OC(C)(C)OC |
| InChI | InChI=1S/C24H36O4/c1-8-10-11-12-15-18-21-22(28-24(5,6)27-21)19-16-13-14-17-20(9-2)26-23(3,4)25-7/h9,15,18,20-22H,2,8,10-12,19H2,1,3-7H3 |
| InChIKey | TWMMXBGORAALOP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|