C20H30O7 — CID 16758933
[2-(ethoxycarbonyloxymethyl)-6-oct-1-ynyl-3,6-dihydro-2H-pyran-3-yl] ethyl carbonate (PubChem CID 16758933) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is [2-(ethoxycarbonyloxymethyl)-6-oct-1-ynyl-3,6-dihydro-2H-pyran-3-yl] ethyl carbonate.
| Compound Name | [2-(ethoxycarbonyloxymethyl)-6-oct-1-ynyl-3,6-dihydro-2H-pyran-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 16758933 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [2-(ethoxycarbonyloxymethyl)-6-oct-1-ynyl-3,6-dihydro-2H-pyran-3-yl] ethyl carbonate |
| SMILES | CCCCCCC#CC1C=CC(OC(=O)OCC)C(COC(=O)OCC)O1 |
| InChI | InChI=1S/C20H30O7/c1-4-7-8-9-10-11-12-16-13-14-17(27-20(22)24-6-3)18(26-16)15-25-19(21)23-5-2/h13-14,16-18H,4-10,15H2,1-3H3 |
| InChIKey | WYCXKVTXXPIGLG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|