C15H22O7 — CID 16758931
[2-(ethoxycarbonyloxymethyl)-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] ethyl carbonate (PubChem CID 16758931) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is [2-(ethoxycarbonyloxymethyl)-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] ethyl carbonate.
| Compound Name | [2-(ethoxycarbonyloxymethyl)-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 16758931 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [2-(ethoxycarbonyloxymethyl)-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] ethyl carbonate |
| SMILES | C=CCC1C=CC(OC(=O)OCC)C(COC(=O)OCC)O1 |
| InChI | InChI=1S/C15H22O7/c1-4-7-11-8-9-12(22-15(17)19-6-3)13(21-11)10-20-14(16)18-5-2/h4,8-9,11-13H,1,5-7,10H2,2-3H3 |
| InChIKey | ZUBOXJYNMWKZQR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|