C23H34O3 — CID 24766767
(4R,5R)-4-heptyl-2,2-dimethyl-5-[(2Z)-2-(2-prop-2-enoxyethylidene)hexa-3,5-diynyl]-1,3-dioxolane (PubChem CID 24766767) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (4R,5R)-4-heptyl-2,2-dimethyl-5-[(2Z)-2-(2-prop-2-enoxyethylidene)hexa-3,5-diynyl]-1,3-dioxolane.
| Compound Name | (4R,5R)-4-heptyl-2,2-dimethyl-5-[(2Z)-2-(2-prop-2-enoxyethylidene)hexa-3,5-diynyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 24766767 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (4R,5R)-4-heptyl-2,2-dimethyl-5-[(2Z)-2-(2-prop-2-enoxyethylidene)hexa-3,5-diynyl]-1,3-dioxolane |
| SMILES | C#CC#C/C(=C\COCC=C)C[C@H]1OC(C)(C)O[C@@H]1CCCCCCC |
| InChI | InChI=1S/C23H34O3/c1-6-9-11-12-13-15-21-22(26-23(4,5)25-21)19-20(14-10-7-2)16-18-24-17-8-3/h2,8,16,21-22H,3,6,9,11-13,15,17-19H2,1,4-5H3/b20-16+/t21-,22-/m1/s1 |
| InChIKey | MQXQHKVYLPZCTD-QRTWOMCZSA-N |
| XLogP | 5.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|