C25H40O3Si — CID 101461398
[(Z)-3-[[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]hept-2-en-4,6-diynoxy]-dimethyl-prop-2-enylsilane (PubChem CID 101461398) has the molecular formula C25H40O3Si and a molecular weight of 416.68 g/mol. Its IUPAC name is [(Z)-3-[[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]hept-2-en-4,6-diynoxy]-dimethyl-prop-2-enylsilane.
| Compound Name | [(Z)-3-[[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]hept-2-en-4,6-diynoxy]-dimethyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 101461398 |
| Molecular Formula | C25H40O3Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | [(Z)-3-[[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]hept-2-en-4,6-diynoxy]-dimethyl-prop-2-enylsilane |
| SMILES | C#CC#C/C(=C\CO[Si](C)(C)CC=C)C[C@H]1OC(C)(C)O[C@@H]1CCCCCCC |
| InChI | InChI=1S/C25H40O3Si/c1-8-11-13-14-15-17-23-24(28-25(4,5)27-23)21-22(16-12-9-2)18-19-26-29(6,7)20-10-3/h2,10,18,23-24H,3,8,11,13-15,17,19-21H2,1,4-7H3/b22-18+/t23-,24-/m1/s1 |
| InChIKey | COMAJRGBBKDLPU-AGSBVHJZSA-N |
| XLogP | 6.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|